C13H12N4O3S — CID 106545345
2-cyano-N-[(6-methoxy-3-pyridinyl)methyl]pyridine-3-sulfonamide (PubChem CID 106545345) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 2-cyano-N-[(6-methoxy-3-pyridinyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-[(6-methoxy-3-pyridinyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106545345 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-cyano-N-[(6-methoxy-3-pyridinyl)methyl]pyridine-3-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cccnc2C#N)cn1 |
| InChI | InChI=1S/C13H12N4O3S/c1-20-13-5-4-10(8-16-13)9-17-21(18,19)12-3-2-6-15-11(12)7-14/h2-6,8,17H,9H2,1H3 |
| InChIKey | TVJVUTWYILLGNB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |