C14H19BrClNO3S — CID 106545578
3-bromo-4-chloro-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 106545578) has the molecular formula C14H19BrClNO3S and a molecular weight of 396.73 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106545578 |
| Molecular Formula | C14H19BrClNO3S |
| Molecular Weight | 396.73 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 3-bromo-4-chloro-N-(1-cyclopropylethyl)-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCN(C(C)C1CC1)S(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H19BrClNO3S/c1-10(11-3-4-11)17(7-8-20-2)21(18,19)12-5-6-14(16)13(15)9-12/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | KWTBYBSOQXDUCM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |