C8H11N3 — CID 106549432
N-cyclopropyl-5-methylpyridazin-3-amine (PubChem CID 106549432) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is N-cyclopropyl-5-methylpyridazin-3-amine.
| Compound Name | N-cyclopropyl-5-methylpyridazin-3-amine |
|---|---|
| PubChem CID | 106549432 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | N-cyclopropyl-5-methylpyridazin-3-amine |
| SMILES | Cc1cnnc(NC2CC2)c1 |
| InChI | InChI=1S/C8H11N3/c1-6-4-8(11-9-5-6)10-7-2-3-7/h4-5,7H,2-3H2,1H3,(H,10,11) |
| InChIKey | HYGAOECMVADLEU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |