C8H15N3 — CID 143330447
N,5-dimethylpyridazin-3-amine;ethane (PubChem CID 143330447) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N,5-dimethylpyridazin-3-amine;ethane.
| Compound Name | N,5-dimethylpyridazin-3-amine;ethane |
|---|---|
| PubChem CID | 143330447 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N,5-dimethylpyridazin-3-amine;ethane |
| SMILES | CC.CNc1cc(C)cnn1 |
| InChI | InChI=1S/C6H9N3.C2H6/c1-5-3-6(7-2)9-8-4-5;1-2/h3-4H,1-2H3,(H,7,9);1-2H3 |
| InChIKey | LTOIOOPOLUFOFC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |