C7H9F2N3 — CID 106549890
N-(2,2-difluoroethyl)-5-methylpyridazin-3-amine (PubChem CID 106549890) has the molecular formula C7H9F2N3 and a molecular weight of 173.17 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-5-methylpyridazin-3-amine.
| Compound Name | N-(2,2-difluoroethyl)-5-methylpyridazin-3-amine |
|---|---|
| PubChem CID | 106549890 |
| Molecular Formula | C7H9F2N3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | N-(2,2-difluoroethyl)-5-methylpyridazin-3-amine |
| SMILES | Cc1cnnc(NCC(F)F)c1 |
| InChI | InChI=1S/C7H9F2N3/c1-5-2-7(12-11-3-5)10-4-6(8)9/h2-3,6H,4H2,1H3,(H,10,12) |
| InChIKey | MFFUPIBMFKZAKN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |