C14H18N4 — CID 106550800
N-[3-(3-aminopropyl)phenyl]-5-methylpyridazin-3-amine (PubChem CID 106550800) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is N-[3-(3-aminopropyl)phenyl]-5-methylpyridazin-3-amine.
| Compound Name | N-[3-(3-aminopropyl)phenyl]-5-methylpyridazin-3-amine |
|---|---|
| PubChem CID | 106550800 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N-[3-(3-aminopropyl)phenyl]-5-methylpyridazin-3-amine |
| SMILES | Cc1cnnc(Nc2cccc(CCCN)c2)c1 |
| InChI | InChI=1S/C14H18N4/c1-11-8-14(18-16-10-11)17-13-6-2-4-12(9-13)5-3-7-15/h2,4,6,8-10H,3,5,7,15H2,1H3,(H,17,18) |
| InChIKey | DVUUWDSNBRMWDJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |