C11H18N4 — CID 106552943
1-(1-cyclopropylimidazol-2-yl)-3-methylpiperazine (PubChem CID 106552943) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(1-cyclopropylimidazol-2-yl)-3-methylpiperazine.
| Compound Name | 1-(1-cyclopropylimidazol-2-yl)-3-methylpiperazine |
|---|---|
| PubChem CID | 106552943 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-(1-cyclopropylimidazol-2-yl)-3-methylpiperazine |
| SMILES | CC1CN(c2nccn2C2CC2)CCN1 |
| InChI | InChI=1S/C11H18N4/c1-9-8-14(6-4-12-9)11-13-5-7-15(11)10-2-3-10/h5,7,9-10,12H,2-4,6,8H2,1H3 |
| InChIKey | AVHNQQFDQAJFDY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |