C8H15N5 — CID 131162793
3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)piperazine (PubChem CID 131162793) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)piperazine.
| Compound Name | 3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)piperazine |
|---|---|
| PubChem CID | 131162793 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)piperazine |
| SMILES | CC1CN(c2nncn2C)CCN1 |
| InChI | InChI=1S/C8H15N5/c1-7-5-13(4-3-9-7)8-11-10-6-12(8)2/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | NGHWDFWWRGZTNC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |