C16H21Cl2N3 — CID 106557976
1-butyl-N-[2-(2,4-dichlorophenyl)ethyl]-4-methylimidazol-2-amine (PubChem CID 106557976) has the molecular formula C16H21Cl2N3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 1-butyl-N-[2-(2,4-dichlorophenyl)ethyl]-4-methylimidazol-2-amine.
| Compound Name | 1-butyl-N-[2-(2,4-dichlorophenyl)ethyl]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106557976 |
| Molecular Formula | C16H21Cl2N3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-butyl-N-[2-(2,4-dichlorophenyl)ethyl]-4-methylimidazol-2-amine |
| SMILES | CCCCn1cc(C)nc1NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N3/c1-3-4-9-21-11-12(2)20-16(21)19-8-7-13-5-6-14(17)10-15(13)18/h5-6,10-11H,3-4,7-9H2,1-2H3,(H,19,20) |
| InChIKey | CXFBTIOCIRMSLY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |