C14H15F2N3O — CID 106561159
N-[4-(difluoromethoxy)phenyl]-4-methyl-1-prop-2-enylimidazol-2-amine (PubChem CID 106561159) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-4-methyl-1-prop-2-enylimidazol-2-amine.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-4-methyl-1-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106561159 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-4-methyl-1-prop-2-enylimidazol-2-amine |
| SMILES | C=CCn1cc(C)nc1Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H15F2N3O/c1-3-8-19-9-10(2)17-14(19)18-11-4-6-12(7-5-11)20-13(15)16/h3-7,9,13H,1,8H2,2H3,(H,17,18) |
| InChIKey | AFRDIBPCTBEINS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|