C12H20O3 — CID 10656178
3-[(E)-4,4-dimethoxybut-2-enoxy]cyclohexene (PubChem CID 10656178) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-[(E)-4,4-dimethoxybut-2-enoxy]cyclohexene.
| Compound Name | 3-[(E)-4,4-dimethoxybut-2-enoxy]cyclohexene |
|---|---|
| PubChem CID | 10656178 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3-[(E)-4,4-dimethoxybut-2-enoxy]cyclohexene |
| SMILES | COC(/C=C/COC1C=CCCC1)OC |
| InChI | InChI=1S/C12H20O3/c1-13-12(14-2)9-6-10-15-11-7-4-3-5-8-11/h4,6-7,9,11-12H,3,5,8,10H2,1-2H3/b9-6+ |
| InChIKey | RRZYVGBEKHYFBT-RMKNXTFCSA-N |
| XLogP | 2.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|