C10H17N3O2 — CID 106563560
N-(1,4-dioxan-2-ylmethyl)-1,4-dimethylimidazol-2-amine (PubChem CID 106563560) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-1,4-dimethylimidazol-2-amine.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-1,4-dimethylimidazol-2-amine |
|---|---|
| PubChem CID | 106563560 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-1,4-dimethylimidazol-2-amine |
| SMILES | Cc1cn(C)c(NCC2COCCO2)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-8-6-13(2)10(12-8)11-5-9-7-14-3-4-15-9/h6,9H,3-5,7H2,1-2H3,(H,11,12) |
| InChIKey | NBKWADAGMAVQQA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |