C7H11N3O2S — CID 65271012
N-(1,4-dioxan-2-ylmethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65271012) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65271012 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | c1nsc(NCC2COCCO2)n1 |
| InChI | InChI=1S/C7H11N3O2S/c1-2-12-6(4-11-1)3-8-7-9-5-10-13-7/h5-6H,1-4H2,(H,8,9,10) |
| InChIKey | BYOBFKPJNICWFW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |