C12H24N4 — CID 106566350
1-[1-(diethylamino)propan-2-yl]-N-ethylimidazol-2-amine (PubChem CID 106566350) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-[1-(diethylamino)propan-2-yl]-N-ethylimidazol-2-amine.
| Compound Name | 1-[1-(diethylamino)propan-2-yl]-N-ethylimidazol-2-amine |
|---|---|
| PubChem CID | 106566350 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 1-[1-(diethylamino)propan-2-yl]-N-ethylimidazol-2-amine |
| SMILES | CCNc1nccn1C(C)CN(CC)CC |
| InChI | InChI=1S/C12H24N4/c1-5-13-12-14-8-9-16(12)11(4)10-15(6-2)7-3/h8-9,11H,5-7,10H2,1-4H3,(H,13,14) |
| InChIKey | HYJGCMCLVPNZQN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |