C10H20N4 — CID 106578657
1-[1-(dimethylamino)propan-2-yl]-N-ethylimidazol-2-amine (PubChem CID 106578657) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 1-[1-(dimethylamino)propan-2-yl]-N-ethylimidazol-2-amine.
| Compound Name | 1-[1-(dimethylamino)propan-2-yl]-N-ethylimidazol-2-amine |
|---|---|
| PubChem CID | 106578657 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 1-[1-(dimethylamino)propan-2-yl]-N-ethylimidazol-2-amine |
| SMILES | CCNc1nccn1C(C)CN(C)C |
| InChI | InChI=1S/C10H20N4/c1-5-11-10-12-6-7-14(10)9(2)8-13(3)4/h6-7,9H,5,8H2,1-4H3,(H,11,12) |
| InChIKey | OYLUQYDDGVHTRF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |