C13H16ClN3 — CID 106566928
1-[1-(2-chlorophenyl)ethyl]-N-ethylimidazol-2-amine (PubChem CID 106566928) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-N-ethylimidazol-2-amine.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-N-ethylimidazol-2-amine |
|---|---|
| PubChem CID | 106566928 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-N-ethylimidazol-2-amine |
| SMILES | CCNc1nccn1C(C)c1ccccc1Cl |
| InChI | InChI=1S/C13H16ClN3/c1-3-15-13-16-8-9-17(13)10(2)11-6-4-5-7-12(11)14/h4-10H,3H2,1-2H3,(H,15,16) |
| InChIKey | KFWBOCJYLKJFBV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |