C14H28Si — CID 10656786
trimethyl-[(1E,3Z)-3-propylocta-1,3-dienyl]silane (PubChem CID 10656786) has the molecular formula C14H28Si and a molecular weight of 224.46 g/mol. Its IUPAC name is trimethyl-[(1E,3Z)-3-propylocta-1,3-dienyl]silane.
| Compound Name | trimethyl-[(1E,3Z)-3-propylocta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 10656786 |
| Molecular Formula | C14H28Si |
| Molecular Weight | 224.46 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | trimethyl-[(1E,3Z)-3-propylocta-1,3-dienyl]silane |
| SMILES | CCCC/C=C(\C=C\[Si](C)(C)C)CCC |
| InChI | InChI=1S/C14H28Si/c1-6-8-9-11-14(10-7-2)12-13-15(3,4)5/h11-13H,6-10H2,1-5H3/b13-12+,14-11- |
| InChIKey | PRSXTLNOAHONMY-XSOQQASASA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|