C12H17N3S — CID 106569695
N-[(5-methylthiophen-2-yl)methyl]-1-propan-2-ylimidazol-2-amine (PubChem CID 106569695) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-1-propan-2-ylimidazol-2-amine.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-1-propan-2-ylimidazol-2-amine |
|---|---|
| PubChem CID | 106569695 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-1-propan-2-ylimidazol-2-amine |
| SMILES | Cc1ccc(CNc2nccn2C(C)C)s1 |
| InChI | InChI=1S/C12H17N3S/c1-9(2)15-7-6-13-12(15)14-8-11-5-4-10(3)16-11/h4-7,9H,8H2,1-3H3,(H,13,14) |
| InChIKey | NNAOQKCMBYLXLN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |