C12H14ClN3 — CID 106570141
1-[(3-chlorophenyl)methyl]-N-ethylimidazol-2-amine (PubChem CID 106570141) has the molecular formula C12H14ClN3 and a molecular weight of 235.72 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N-ethylimidazol-2-amine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N-ethylimidazol-2-amine |
|---|---|
| PubChem CID | 106570141 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N-ethylimidazol-2-amine |
| SMILES | CCNc1nccn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H14ClN3/c1-2-14-12-15-6-7-16(12)9-10-4-3-5-11(13)8-10/h3-8H,2,9H2,1H3,(H,14,15) |
| InChIKey | SRGKPGDHXZDFAN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |