C15H20O2 — CID 10657225
3-but-3-enyl-2-hex-1-ynyl-4-hydroxy-4-methylcyclobut-2-en-1-one (PubChem CID 10657225) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 3-but-3-enyl-2-hex-1-ynyl-4-hydroxy-4-methylcyclobut-2-en-1-one.
| Compound Name | 3-but-3-enyl-2-hex-1-ynyl-4-hydroxy-4-methylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10657225 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 3-but-3-enyl-2-hex-1-ynyl-4-hydroxy-4-methylcyclobut-2-en-1-one |
| SMILES | C=CCCC1=C(C#CCCCC)C(=O)C1(C)O |
| InChI | InChI=1S/C15H20O2/c1-4-6-8-9-10-12-13(11-7-5-2)15(3,17)14(12)16/h5,17H,2,4,6-8,11H2,1,3H3 |
| InChIKey | BPCGYFHHKOCPHX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|