C18H28O2Si — CID 10662327
3-but-3-enyl-2-hex-1-ynyl-4-methyl-4-trimethylsilyloxycyclobut-2-en-1-one (PubChem CID 10662327) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is 3-but-3-enyl-2-hex-1-ynyl-4-methyl-4-trimethylsilyloxycyclobut-2-en-1-one.
| Compound Name | 3-but-3-enyl-2-hex-1-ynyl-4-methyl-4-trimethylsilyloxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10662327 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3-but-3-enyl-2-hex-1-ynyl-4-methyl-4-trimethylsilyloxycyclobut-2-en-1-one |
| SMILES | C=CCCC1=C(C#CCCCC)C(=O)C1(C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H28O2Si/c1-7-9-11-12-13-15-16(14-10-8-2)18(3,17(15)19)20-21(4,5)6/h8H,2,7,9-11,14H2,1,3-6H3 |
| InChIKey | XTDGDTUXPBESLL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|