C17H28O2Si2 — CID 10734506
3-but-3-enyl-4-methyl-2-(2-trimethylsilylethynyl)-4-trimethylsilyloxycyclobut-2-en-1-one (PubChem CID 10734506) has the molecular formula C17H28O2Si2 and a molecular weight of 320.58 g/mol. Its IUPAC name is 3-but-3-enyl-4-methyl-2-(2-trimethylsilylethynyl)-4-trimethylsilyloxycyclobut-2-en-1-one.
| Compound Name | 3-but-3-enyl-4-methyl-2-(2-trimethylsilylethynyl)-4-trimethylsilyloxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10734506 |
| Molecular Formula | C17H28O2Si2 |
| Molecular Weight | 320.58 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-but-3-enyl-4-methyl-2-(2-trimethylsilylethynyl)-4-trimethylsilyloxycyclobut-2-en-1-one |
| SMILES | C=CCCC1=C(C#C[Si](C)(C)C)C(=O)C1(C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H28O2Si2/c1-9-10-11-15-14(12-13-20(3,4)5)16(18)17(15,2)19-21(6,7)8/h9H,1,10-11H2,2-8H3 |
| InChIKey | QXARXSPZZWMEKM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|