C13H21N3 — CID 106575615
N-cyclopropyl-1-(2,3-dimethylcyclopentyl)imidazol-2-amine (PubChem CID 106575615) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-cyclopropyl-1-(2,3-dimethylcyclopentyl)imidazol-2-amine.
| Compound Name | N-cyclopropyl-1-(2,3-dimethylcyclopentyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106575615 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-cyclopropyl-1-(2,3-dimethylcyclopentyl)imidazol-2-amine |
| SMILES | CC1CCC(n2ccnc2NC2CC2)C1C |
| InChI | InChI=1S/C13H21N3/c1-9-3-6-12(10(9)2)16-8-7-14-13(16)15-11-4-5-11/h7-12H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | OCGVLCRSNYRXKM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |