C15H25N3O — CID 106578838
N-cyclopropyl-1-(2,2-diethyloxan-4-yl)imidazol-2-amine (PubChem CID 106578838) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is N-cyclopropyl-1-(2,2-diethyloxan-4-yl)imidazol-2-amine.
| Compound Name | N-cyclopropyl-1-(2,2-diethyloxan-4-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 106578838 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | N-cyclopropyl-1-(2,2-diethyloxan-4-yl)imidazol-2-amine |
| SMILES | CCC1(CC)CC(n2ccnc2NC2CC2)CCO1 |
| InChI | InChI=1S/C15H25N3O/c1-3-15(4-2)11-13(7-10-19-15)18-9-8-16-14(18)17-12-5-6-12/h8-9,12-13H,3-7,10-11H2,1-2H3,(H,16,17) |
| InChIKey | HWIHMVKQKNVTEE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |