C14H25N3O — CID 106578808
1-(2,2-diethyloxan-4-yl)-N,4-dimethylimidazol-2-amine (PubChem CID 106578808) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-(2,2-diethyloxan-4-yl)-N,4-dimethylimidazol-2-amine.
| Compound Name | 1-(2,2-diethyloxan-4-yl)-N,4-dimethylimidazol-2-amine |
|---|---|
| PubChem CID | 106578808 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-(2,2-diethyloxan-4-yl)-N,4-dimethylimidazol-2-amine |
| SMILES | CCC1(CC)CC(n2cc(C)nc2NC)CCO1 |
| InChI | InChI=1S/C14H25N3O/c1-5-14(6-2)9-12(7-8-18-14)17-10-11(3)16-13(17)15-4/h10,12H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | BTVNWZLQYKZEBL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |