C12H21N3O2 — CID 106659872
N-(2,2-diethyloxan-4-yl)-3-methyl-1,2,4-oxadiazol-5-amine (PubChem CID 106659872) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-(2,2-diethyloxan-4-yl)-3-methyl-1,2,4-oxadiazol-5-amine.
| Compound Name | N-(2,2-diethyloxan-4-yl)-3-methyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 106659872 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N-(2,2-diethyloxan-4-yl)-3-methyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCC1(CC)CC(Nc2nc(C)no2)CCO1 |
| InChI | InChI=1S/C12H21N3O2/c1-4-12(5-2)8-10(6-7-16-12)14-11-13-9(3)15-17-11/h10H,4-8H2,1-3H3,(H,13,14,15) |
| InChIKey | LDCYZIVTZGVNRB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |