C15H27N3 — CID 106577493
N-cyclopropyl-1-(2,2-dimethylheptyl)imidazol-2-amine (PubChem CID 106577493) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N-cyclopropyl-1-(2,2-dimethylheptyl)imidazol-2-amine.
| Compound Name | N-cyclopropyl-1-(2,2-dimethylheptyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106577493 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N-cyclopropyl-1-(2,2-dimethylheptyl)imidazol-2-amine |
| SMILES | CCCCCC(C)(C)Cn1ccnc1NC1CC1 |
| InChI | InChI=1S/C15H27N3/c1-4-5-6-9-15(2,3)12-18-11-10-16-14(18)17-13-7-8-13/h10-11,13H,4-9,12H2,1-3H3,(H,16,17) |
| InChIKey | IFMHOCAPPCMTEZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|