C12H18O5 — CID 10657777
(3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde (PubChem CID 10657777) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde.
| Compound Name | (3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 10657777 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
| SMILES | C=CC[C@@]1(OC)[C@@H](C=O)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H18O5/c1-5-6-12(14-4)8(7-13)15-10-9(12)16-11(2,3)17-10/h5,7-10H,1,6H2,2-4H3/t8-,9+,10-,12-/m1/s1 |
| InChIKey | ORFWEHARPRUTFQ-DTHBNOIPSA-N |
| XLogP | 1.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|