C16H18N4S — CID 106579895
N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-phenylimidazol-2-amine (PubChem CID 106579895) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-phenylimidazol-2-amine.
| Compound Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-phenylimidazol-2-amine |
|---|---|
| PubChem CID | 106579895 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-phenylimidazol-2-amine |
| SMILES | CCc1cnc(C(C)Nc2nccn2-c2ccccc2)s1 |
| InChI | InChI=1S/C16H18N4S/c1-3-14-11-18-15(21-14)12(2)19-16-17-9-10-20(16)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3,(H,17,19) |
| InChIKey | GHZAATNLSPMKKN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |