C14H16N4S — CID 112547613
N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1H-benzimidazol-2-amine (PubChem CID 112547613) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1H-benzimidazol-2-amine.
| Compound Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 112547613 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1H-benzimidazol-2-amine |
| SMILES | CCc1cnc(C(C)Nc2nc3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C14H16N4S/c1-3-10-8-15-13(19-10)9(2)16-14-17-11-6-4-5-7-12(11)18-14/h4-9H,3H2,1-2H3,(H2,16,17,18) |
| InChIKey | JJYBSFLBQDNSNU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |