C15H27NS — CID 10658554
(E)-N-(methylsulfanylmethyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-amine (PubChem CID 10658554) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is (E)-N-(methylsulfanylmethyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-amine.
| Compound Name | (E)-N-(methylsulfanylmethyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-amine |
|---|---|
| PubChem CID | 10658554 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | (E)-N-(methylsulfanylmethyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-amine |
| SMILES | CSCNC(C)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C15H27NS/c1-12-7-6-10-15(3,4)14(12)9-8-13(2)16-11-17-5/h7-9,13-14,16H,6,10-11H2,1-5H3/b9-8+ |
| InChIKey | MQPFCOPXRXIPJB-CMDGGOBGSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|