C15H24N2S — CID 10730356
[[(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]amino]methyl thiocyanate (PubChem CID 10730356) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is [[(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]amino]methyl thiocyanate.
| Compound Name | [[(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]amino]methyl thiocyanate |
|---|---|
| PubChem CID | 10730356 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [[(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]amino]methyl thiocyanate |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(C)NCSC#N |
| InChI | InChI=1S/C15H24N2S/c1-12-6-5-9-15(3,4)14(12)8-7-13(2)17-11-18-10-16/h6-8,13-14,17H,5,9,11H2,1-4H3/b8-7+ |
| InChIKey | WMCXXWNNZOUCLV-BQYQJAHWSA-N |
| XLogP | 4.07 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|