C14H24N2O5 — CID 106588033
2-[4-[3-(methoxymethyl)piperidine-1-carbonyl]morpholin-3-yl]acetic acid (PubChem CID 106588033) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[4-[3-(methoxymethyl)piperidine-1-carbonyl]morpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(methoxymethyl)piperidine-1-carbonyl]morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 106588033 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[4-[3-(methoxymethyl)piperidine-1-carbonyl]morpholin-3-yl]acetic acid |
| SMILES | COCC1CCCN(C(=O)N2CCOCC2CC(=O)O)C1 |
| InChI | InChI=1S/C14H24N2O5/c1-20-9-11-3-2-4-15(8-11)14(19)16-5-6-21-10-12(16)7-13(17)18/h11-12H,2-10H2,1H3,(H,17,18) |
| InChIKey | DOSJQKZMOHALLC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |