C15H24N2O4 — CID 82753207
2-[4-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)morpholin-3-yl]acetic acid (PubChem CID 82753207) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[4-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)morpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 82753207 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[4-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)morpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1COCCN1C(=O)N1CCC2CCCCC21 |
| InChI | InChI=1S/C15H24N2O4/c18-14(19)9-12-10-21-8-7-16(12)15(20)17-6-5-11-3-1-2-4-13(11)17/h11-13H,1-10H2,(H,18,19) |
| InChIKey | WWAIVXXHQYQGSN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |