About 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid
2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid (PubChem CID 114172612) has the molecular formula C13H20N2O4
and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid |
| PubChem CID | 114172612 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid |
| SMILES | CC1=CCCN(C(=O)N2CCOCC2CC(=O)O)C1 |
| InChI | InChI=1S/C13H20N2O4/c1-10-3-2-4-14(8-10)13(18)15-5-6-19-9-11(15)7-12(16)17/h3,11H,2,4-9H2,1H3,(H,16,17) |
| InChIKey | SZPBGZKZYFWBLO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid?
The IUPAC name of 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid (CID 114172612) is 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid.
What is the SMILES notation for 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid?
The canonical SMILES for 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid is CC1=CCCN(C(=O)N2CCOCC2CC(=O)O)C1.
What is the InChIKey of 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid?
The InChIKey is SZPBGZKZYFWBLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O4/c1-10-3-2-4-14(8-10)13(18)15-5-6-19-9-11(15)7-12(16)17/h3,11H,2,4-9H2,1H3,(H,16,17).
What are the key properties of 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid?
2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid has a molecular weight of 268.31 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)morpholin-3-yl]acetic acid is sourced from PubChem (CID 114172612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).