C14H27NO3 — CID 10658819
2-[(2R,6S)-1-(2-hydroxyethyl)-6-pentylpiperidin-2-yl]acetic acid (PubChem CID 10658819) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is 2-[(2R,6S)-1-(2-hydroxyethyl)-6-pentylpiperidin-2-yl]acetic acid.
| Compound Name | 2-[(2R,6S)-1-(2-hydroxyethyl)-6-pentylpiperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 10658819 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 2-[(2R,6S)-1-(2-hydroxyethyl)-6-pentylpiperidin-2-yl]acetic acid |
| SMILES | CCCCC[C@H]1CCC[C@H](CC(=O)O)N1CCO |
| InChI | InChI=1S/C14H27NO3/c1-2-3-4-6-12-7-5-8-13(11-14(17)18)15(12)9-10-16/h12-13,16H,2-11H2,1H3,(H,17,18)/t12-,13+/m0/s1 |
| InChIKey | BBWGXHKVOKITQA-QWHCGFSZSA-N |
| XLogP | 2.26 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|