C12H17NO5S — CID 106589861
5-[3-(methoxymethyl)piperidin-1-yl]sulfonylfuran-2-carbaldehyde (PubChem CID 106589861) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-[3-(methoxymethyl)piperidin-1-yl]sulfonylfuran-2-carbaldehyde.
| Compound Name | 5-[3-(methoxymethyl)piperidin-1-yl]sulfonylfuran-2-carbaldehyde |
|---|---|
| PubChem CID | 106589861 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 5-[3-(methoxymethyl)piperidin-1-yl]sulfonylfuran-2-carbaldehyde |
| SMILES | COCC1CCCN(S(=O)(=O)c2ccc(C=O)o2)C1 |
| InChI | InChI=1S/C12H17NO5S/c1-17-9-10-3-2-6-13(7-10)19(15,16)12-5-4-11(8-14)18-12/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | QJEWYHDHKISTDY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|