C13H22N2O4S — CID 106590010
[4-[3-(methoxymethyl)piperidin-1-yl]sulfonyl-5-methylfuran-2-yl]methanamine (PubChem CID 106590010) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is [4-[3-(methoxymethyl)piperidin-1-yl]sulfonyl-5-methylfuran-2-yl]methanamine.
| Compound Name | [4-[3-(methoxymethyl)piperidin-1-yl]sulfonyl-5-methylfuran-2-yl]methanamine |
|---|---|
| PubChem CID | 106590010 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [4-[3-(methoxymethyl)piperidin-1-yl]sulfonyl-5-methylfuran-2-yl]methanamine |
| SMILES | COCC1CCCN(S(=O)(=O)c2cc(CN)oc2C)C1 |
| InChI | InChI=1S/C13H22N2O4S/c1-10-13(6-12(7-14)19-10)20(16,17)15-5-3-4-11(8-15)9-18-2/h6,11H,3-5,7-9,14H2,1-2H3 |
| InChIKey | NDGQKJMNWZLATL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |