C15H18O4 — CID 10659144
methyl 3-[(5E)-5-[(2E,4E)-hexa-2,4-dienylidene]-2-oxopyran-3-yl]propanoate (PubChem CID 10659144) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl 3-[(5E)-5-[(2E,4E)-hexa-2,4-dienylidene]-2-oxopyran-3-yl]propanoate.
| Compound Name | methyl 3-[(5E)-5-[(2E,4E)-hexa-2,4-dienylidene]-2-oxopyran-3-yl]propanoate |
|---|---|
| PubChem CID | 10659144 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl 3-[(5E)-5-[(2E,4E)-hexa-2,4-dienylidene]-2-oxopyran-3-yl]propanoate |
| SMILES | C/C=C/C=C/C=C1\C=C(CCC(=O)OC)C(=O)OC1 |
| InChI | InChI=1S/C15H18O4/c1-3-4-5-6-7-12-10-13(15(17)19-11-12)8-9-14(16)18-2/h3-7,10H,8-9,11H2,1-2H3/b4-3+,6-5+,12-7+ |
| InChIKey | KHSXUDZYEGKECS-VEKDZCNTSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|