C8H16N4O — CID 106598275
N-[2-[(1-methyl-1,2,4-triazol-3-yl)oxy]ethyl]propan-2-amine (PubChem CID 106598275) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is N-[2-[(1-methyl-1,2,4-triazol-3-yl)oxy]ethyl]propan-2-amine.
| Compound Name | N-[2-[(1-methyl-1,2,4-triazol-3-yl)oxy]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 106598275 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | N-[2-[(1-methyl-1,2,4-triazol-3-yl)oxy]ethyl]propan-2-amine |
| SMILES | CC(C)NCCOc1ncn(C)n1 |
| InChI | InChI=1S/C8H16N4O/c1-7(2)9-4-5-13-8-10-6-12(3)11-8/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | AOJLRNIOWAITSZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|