C10H18N4O3 — CID 62348985
2,4-dimethyl-6-[2-(propan-2-ylamino)ethoxy]-1,2,4-triazine-3,5-dione (PubChem CID 62348985) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2,4-dimethyl-6-[2-(propan-2-ylamino)ethoxy]-1,2,4-triazine-3,5-dione.
| Compound Name | 2,4-dimethyl-6-[2-(propan-2-ylamino)ethoxy]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 62348985 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 2,4-dimethyl-6-[2-(propan-2-ylamino)ethoxy]-1,2,4-triazine-3,5-dione |
| SMILES | CC(C)NCCOc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H18N4O3/c1-7(2)11-5-6-17-8-9(15)13(3)10(16)14(4)12-8/h7,11H,5-6H2,1-4H3 |
| InChIKey | UYPOMMRUEYLHRB-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|