C12H23N3O — CID 81345697
4-(2,5-dimethylpyrazol-3-yl)oxy-N-propan-2-ylbutan-1-amine (PubChem CID 81345697) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrazol-3-yl)oxy-N-propan-2-ylbutan-1-amine.
| Compound Name | 4-(2,5-dimethylpyrazol-3-yl)oxy-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 81345697 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 4-(2,5-dimethylpyrazol-3-yl)oxy-N-propan-2-ylbutan-1-amine |
| SMILES | Cc1cc(OCCCCNC(C)C)n(C)n1 |
| InChI | InChI=1S/C12H23N3O/c1-10(2)13-7-5-6-8-16-12-9-11(3)14-15(12)4/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | BLUJGXLQPFBRCO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|