C12H22O5Si — CID 10659956
[(3aS,6S,7R,7aS)-6-methoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-dimethyl-prop-2-enylsilane (PubChem CID 10659956) has the molecular formula C12H22O5Si and a molecular weight of 274.39 g/mol. Its IUPAC name is [(3aS,6S,7R,7aS)-6-methoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-dimethyl-prop-2-enylsilane.
| Compound Name | [(3aS,6S,7R,7aS)-6-methoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-dimethyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 10659956 |
| Molecular Formula | C12H22O5Si |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [(3aS,6S,7R,7aS)-6-methoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-dimethyl-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)O[C@H]1[C@@H](OC)OC[C@@H]2OCO[C@H]12 |
| InChI | InChI=1S/C12H22O5Si/c1-5-6-18(3,4)17-11-10-9(15-8-16-10)7-14-12(11)13-2/h5,9-12H,1,6-8H2,2-4H3/t9-,10-,11+,12-/m0/s1 |
| InChIKey | QSGJEBKTYOSNTC-YFKTTZPYSA-N |
| XLogP | 1.51 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|