C13H24O5Si — CID 15478672
[(3aS,4S,7R,7aR)-4-methoxy-2,2-dimethyl-6-methylidene-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-trimethylsilane (PubChem CID 15478672) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is [(3aS,4S,7R,7aR)-4-methoxy-2,2-dimethyl-6-methylidene-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-trimethylsilane.
| Compound Name | [(3aS,4S,7R,7aR)-4-methoxy-2,2-dimethyl-6-methylidene-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15478672 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [(3aS,4S,7R,7aR)-4-methoxy-2,2-dimethyl-6-methylidene-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-trimethylsilane |
| SMILES | C=C1O[C@H](OC)[C@H]2OC(C)(C)O[C@H]2[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C13H24O5Si/c1-8-9(18-19(5,6)7)10-11(12(14-4)15-8)17-13(2,3)16-10/h9-12H,1H2,2-7H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | CBBVICWIQXQYMQ-BJDJZHNGSA-N |
| XLogP | 2.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|