C15H30O5Si — CID 138966083
[(3aS,6S)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 138966083) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is [(3aS,6S)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,6S)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 138966083 |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [(3aS,6S)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@H]1OC[C@@H]2OC(C)(C)OC2C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O5Si/c1-14(2,3)21(7,8)20-12-11-10(9-17-13(12)16-6)18-15(4,5)19-11/h10-13H,9H2,1-8H3/t10-,11?,12?,13-/m0/s1 |
| InChIKey | AEICCPZMEUOLKL-WTIISPKJSA-N |
| XLogP | 2.90 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|