C16H32O2Si — CID 10660762
triethyl-[(Z,2S)-2-prop-1-en-2-yloxyhept-3-enoxy]silane (PubChem CID 10660762) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is triethyl-[(Z,2S)-2-prop-1-en-2-yloxyhept-3-enoxy]silane.
| Compound Name | triethyl-[(Z,2S)-2-prop-1-en-2-yloxyhept-3-enoxy]silane |
|---|---|
| PubChem CID | 10660762 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | triethyl-[(Z,2S)-2-prop-1-en-2-yloxyhept-3-enoxy]silane |
| SMILES | C=C(C)O[C@@H](/C=C\CCC)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H32O2Si/c1-7-11-12-13-16(18-15(5)6)14-17-19(8-2,9-3)10-4/h12-13,16H,5,7-11,14H2,1-4,6H3/b13-12-/t16-/m0/s1 |
| InChIKey | XXBHQAUOHORABV-AHKFDXCISA-N |
| XLogP | 5.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|