C14H19BrClNO2S — CID 106612261
3-bromo-4-chloro-N-[(4-methylcyclohexyl)methyl]benzenesulfonamide (PubChem CID 106612261) has the molecular formula C14H19BrClNO2S and a molecular weight of 380.74 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[(4-methylcyclohexyl)methyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-[(4-methylcyclohexyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106612261 |
| Molecular Formula | C14H19BrClNO2S |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 3-bromo-4-chloro-N-[(4-methylcyclohexyl)methyl]benzenesulfonamide |
| SMILES | CC1CCC(CNS(=O)(=O)c2ccc(Cl)c(Br)c2)CC1 |
| InChI | InChI=1S/C14H19BrClNO2S/c1-10-2-4-11(5-3-10)9-17-20(18,19)12-6-7-14(16)13(15)8-12/h6-8,10-11,17H,2-5,9H2,1H3 |
| InChIKey | HTNKLUSLMURTPQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |