C18H28O3 — CID 10661340
(4,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl) 3,3-dimethylbutanoate (PubChem CID 10661340) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (4,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl) 3,3-dimethylbutanoate.
| Compound Name | (4,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl) 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 10661340 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (4,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl) 3,3-dimethylbutanoate |
| SMILES | CC1=C2CCCCC2(C)CC(OC(=O)CC(C)(C)C)C1=O |
| InChI | InChI=1S/C18H28O3/c1-12-13-8-6-7-9-18(13,5)10-14(16(12)20)21-15(19)11-17(2,3)4/h14H,6-11H2,1-5H3 |
| InChIKey | XQXZFHOOAQPQCV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |