C17H28O4 — CID 10661638
(1,2-dicyclohexyl-2-oxoethyl) ethyl carbonate (PubChem CID 10661638) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (1,2-dicyclohexyl-2-oxoethyl) ethyl carbonate.
| Compound Name | (1,2-dicyclohexyl-2-oxoethyl) ethyl carbonate |
|---|---|
| PubChem CID | 10661638 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (1,2-dicyclohexyl-2-oxoethyl) ethyl carbonate |
| SMILES | CCOC(=O)OC(C(=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C17H28O4/c1-2-20-17(19)21-16(14-11-7-4-8-12-14)15(18)13-9-5-3-6-10-13/h13-14,16H,2-12H2,1H3 |
| InChIKey | SPBFMCZEPZFGPR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |