C17H32O2Si — CID 10661663
(1S,3aS,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,3,3a,4,5,7a-hexahydroinden-1-ol (PubChem CID 10661663) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (1S,3aS,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,3,3a,4,5,7a-hexahydroinden-1-ol.
| Compound Name | (1S,3aS,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,3,3a,4,5,7a-hexahydroinden-1-ol |
|---|---|
| PubChem CID | 10661663 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (1S,3aS,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,3,3a,4,5,7a-hexahydroinden-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C[C@H]2[C@@H](CC1)CC[C@]2(C)O |
| InChI | InChI=1S/C17H32O2Si/c1-16(2,3)20(5,6)19-12-13-7-8-14-9-10-17(4,18)15(14)11-13/h11,14-15,18H,7-10,12H2,1-6H3/t14-,15-,17-/m0/s1 |
| InChIKey | YZADHZMCZSAKLX-ZOBUZTSGSA-N |
| XLogP | 4.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|